Products 1025797-90-3
CAS 1025797-90-3 is the registry number for (5-methylisoxazol-3-yl)((2-(trifluoromethyl)phenyl)sulfonyl)amine. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg, 2000mg.
N-(5-methyl-1,2-oxazol-3-yl)-2-(trifluoromethyl)benzenesulfonamide (CAS 1025797-90-3) is a chemical compound with the molecular formula C11H9F3N2O3S and a molecular weight of 306.26 g/mol. IUPAC name: N-(5-methyl-1,2-oxazol-3-yl)-2-(trifluoromethyl)benzenesulfonamide. InChIKey: FACSKMSBHYGXAG-UHFFFAOYSA-N.
| Molecular formula | C11H9F3N2O3S |
|---|---|
| Molecular weight | 306.26 g/mol |
| IUPAC name | N-(5-methyl-1,2-oxazol-3-yl)-2-(trifluoromethyl)benzenesulfonamide |
| InChIKey | FACSKMSBHYGXAG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NO1)NS(=O)(=O)C2=CC=CC=C2C(F)(F)F |
Computed by PubChem (NCBI)