Products 861241-35-2
CAS 861241-35-2 is the registry number for 2-(Ethanesulfonyl)-4-(furan-2-yl)-6-(trifluoromethyl)pyrimidine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-ethylsulfonyl-4-(furan-2-yl)-6-(trifluoromethyl)pyrimidine (CAS 861241-35-2) is a chemical compound with the molecular formula C11H9F3N2O3S and a molecular weight of 306.26 g/mol. IUPAC name: 2-ethylsulfonyl-4-(furan-2-yl)-6-(trifluoromethyl)pyrimidine. InChIKey: JTXVWGDXVBTBOE-UHFFFAOYSA-N.
| Molecular formula | C11H9F3N2O3S |
|---|---|
| Molecular weight | 306.26 g/mol |
| IUPAC name | 2-ethylsulfonyl-4-(furan-2-yl)-6-(trifluoromethyl)pyrimidine |
| InChIKey | JTXVWGDXVBTBOE-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=NC(=CC(=N1)C(F)(F)F)C2=CC=CO2 |
Computed by PubChem (NCBI)