CAS 1353000-13-1 is the registry number for N–Methyl–N–(6–(trifluoromethoxy)–1,3–benzothiazol–2–yl)glycine. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
2-[methyl-[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]acetic acid (CAS 1353000-13-1) is a chemical compound with the molecular formula C11H9F3N2O3S and a molecular weight of 306.26 g/mol. IUPAC name: 2-[methyl-[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]acetic acid. InChIKey: UOAAZCDVNVZFPL-UHFFFAOYSA-N.
| Molecular formula | C11H9F3N2O3S |
|---|---|
| Molecular weight | 306.26 g/mol |
| IUPAC name | 2-[methyl-[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]acetic acid |
| InChIKey | UOAAZCDVNVZFPL-UHFFFAOYSA-N |
| SMILES | CN(CC(=O)O)C1=NC2=C(S1)C=C(C=C2)OC(F)(F)F |
Computed by PubChem (NCBI)