Products 1025892-26-5
CAS 1025892-26-5 appears in our catalog under these names: Ethyl Benzoylformate-d5, Ethyl phenylglyoxylate-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5g, 250mg, 1 g, 100 mg.
Ethyl 2-oxo-2-(2,3,4,5,6-pentadeuteriophenyl)acetate (CAS 1025892-26-5) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 183.21 g/mol. IUPAC name: ethyl 2-oxo-2-(2,3,4,5,6-pentadeuteriophenyl)acetate. InChIKey: QKLCQKPAECHXCQ-DKFMXDSJSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 183.21 g/mol |
| IUPAC name | ethyl 2-oxo-2-(2,3,4,5,6-pentadeuteriophenyl)acetate |
| InChIKey | QKLCQKPAECHXCQ-DKFMXDSJSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(=O)C(=O)OCC)[2H])[2H] |
Computed by PubChem (NCBI)