Products 1025974-23-5

CAS 1025974-23-5 is the registry number for Faropenem Impurity 16. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(5Z)-3-formyl-5-(4-hydroxybutylidene)-2-methyl-2H-thiophene-4-carboxylic acid (CAS 1025974-23-5) is a chemical compound with the molecular formula C11H14O4S and a molecular weight of 242.29 g/mol. IUPAC name: (5Z)-3-formyl-5-(4-hydroxybutylidene)-2-methyl-2H-thiophene-4-carboxylic acid. InChIKey: NDBSQHJUEWUZKS-WTKPLQERSA-N.

Identity
Molecular formulaC11H14O4S
Molecular weight242.29 g/mol
IUPAC name(5Z)-3-formyl-5-(4-hydroxybutylidene)-2-methyl-2H-thiophene-4-carboxylic acid
InChIKeyNDBSQHJUEWUZKS-WTKPLQERSA-N
SMILESCC1C(=C(/C(=C/CCCO)/S1)C(=O)O)C=O

Computed by PubChem (NCBI)