Products 102601-37-6

CAS 102601-37-6 is the registry number for Z-beta-Ala-Gly-Gly-OH. Offered by: Biosynth. Available pack sizes: 25g, 10g, 50g.

Structural formula: {0} (CAS {1})

2-[[2-[3-(phenylmethoxycarbonylamino)propanoylamino]acetyl]amino]acetic acid (CAS 102601-37-6) is a chemical compound with the molecular formula C15H19N3O6 and a molecular weight of 337.33 g/mol. IUPAC name: 2-[[2-[3-(phenylmethoxycarbonylamino)propanoylamino]acetyl]amino]acetic acid. InChIKey: CDYQJXMBPMBMSE-UHFFFAOYSA-N.

Identity
Molecular formulaC15H19N3O6
Molecular weight337.33 g/mol
IUPAC name2-[[2-[3-(phenylmethoxycarbonylamino)propanoylamino]acetyl]amino]acetic acid
InChIKeyCDYQJXMBPMBMSE-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC(=O)NCCC(=O)NCC(=O)NCC(=O)O

Computed by PubChem (NCBI)