Products 6154-39-8

CAS 6154-39-8 appears in our catalog under these names: Z-Gly-gln-oh, 98%, Z-Gly-Gln-OH, 95% (HPLC), 95% (HPLC), Cbz-Gly-Gln-OH, 95% (HPLC). Offered by: Combi-blocks, Chemat, Ambeed. Available pack sizes: 5g, 1g, 10g.

Structural formula: {0} (CAS {1})

(2S)-5-amino-5-oxo-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]pentanoic acid (CAS 6154-39-8) is a chemical compound with the molecular formula C15H19N3O6 and a molecular weight of 337.33 g/mol. IUPAC name: (2S)-5-amino-5-oxo-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]pentanoic acid. InChIKey: BYMPQNRKDGXXFG-NSHDSACASA-N.

Identity
Molecular formulaC15H19N3O6
Molecular weight337.33 g/mol
IUPAC name(2S)-5-amino-5-oxo-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]pentanoic acid
InChIKeyBYMPQNRKDGXXFG-NSHDSACASA-N
SMILESC1=CC=C(C=C1)COC(=O)NCC(=O)N[C@@H](CCC(=O)N)C(=O)O

Computed by PubChem (NCBI)