Products 19912-36-8

CAS 19912-36-8 is the registry number for Z-Gly-Gly-Ala-OH. Offered by: Biosynth. Available pack sizes: 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

2-[[2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]propanoic acid (CAS 19912-36-8) is a chemical compound with the molecular formula C15H19N3O6 and a molecular weight of 337.33 g/mol. IUPAC name: 2-[[2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]propanoic acid. InChIKey: BGGKRFZYJZIAOK-UHFFFAOYSA-N.

Identity
Molecular formulaC15H19N3O6
Molecular weight337.33 g/mol
IUPAC name2-[[2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]propanoic acid
InChIKeyBGGKRFZYJZIAOK-UHFFFAOYSA-N
SMILESCC(C(=O)O)NC(=O)CNC(=O)CNC(=O)OCC1=CC=CC=C1

Computed by PubChem (NCBI)