CAS 1026033-57-7 is the registry number for 3-(4-Chlorophenyl)-9-phenyl-9H-carbazole, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-chlorophenyl)-9-phenylcarbazole (CAS 1026033-57-7) is a chemical compound with the molecular formula C24H16ClN and a molecular weight of 353.8 g/mol. IUPAC name: 3-(4-chlorophenyl)-9-phenylcarbazole. InChIKey: ZZKCBPJODOKSAJ-UHFFFAOYSA-N.
| Molecular formula | C24H16ClN |
|---|---|
| Molecular weight | 353.8 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-9-phenylcarbazole |
| InChIKey | ZZKCBPJODOKSAJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=C(C=C(C=C3)C4=CC=C(C=C4)Cl)C5=CC=CC=C52 |
Computed by PubChem (NCBI)