CAS 2414983-04-1 is the registry number for 9-(3-Chloro[1,1′-biphenyl]-4-yl)-9H-carbazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
9-(2-chloro-4-phenylphenyl)carbazole (CAS 2414983-04-1) is a chemical compound with the molecular formula C24H16ClN and a molecular weight of 353.8 g/mol. IUPAC name: 9-(2-chloro-4-phenylphenyl)carbazole. InChIKey: WGTIEVMMQCFZFN-UHFFFAOYSA-N.
| Molecular formula | C24H16ClN |
|---|---|
| Molecular weight | 353.8 g/mol |
| IUPAC name | 9-(2-chloro-4-phenylphenyl)carbazole |
| InChIKey | WGTIEVMMQCFZFN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2)N3C4=CC=CC=C4C5=CC=CC=C53)Cl |
Computed by PubChem (NCBI)