CAS 1651187-59-5 is the registry number for 4–(4–Chlorophenyl)–9–phenyl–9H–carbazole. Offered by: GLPBio. Available pack sizes: 1g.
4-(4-chlorophenyl)-9-phenylcarbazole (CAS 1651187-59-5) is a chemical compound with the molecular formula C24H16ClN and a molecular weight of 353.8 g/mol. IUPAC name: 4-(4-chlorophenyl)-9-phenylcarbazole. InChIKey: MADZFZBLFKSTOR-UHFFFAOYSA-N.
| Molecular formula | C24H16ClN |
|---|---|
| Molecular weight | 353.8 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-9-phenylcarbazole |
| InChIKey | MADZFZBLFKSTOR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=CC=CC=C3C4=C(C=CC=C42)C5=CC=C(C=C5)Cl |
Computed by PubChem (NCBI)