Products 1026183-64-1
CAS 1026183-64-1 is the registry number for 2-Amino-N-ethyl-5-fluorobenzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-amino-N-ethyl-5-fluorobenzenesulfonamide (CAS 1026183-64-1) is a chemical compound with the molecular formula C8H11FN2O2S and a molecular weight of 218.25 g/mol. IUPAC name: 2-amino-N-ethyl-5-fluorobenzenesulfonamide. InChIKey: DZLOYRBUNGDYHI-UHFFFAOYSA-N.
| Molecular formula | C8H11FN2O2S |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 2-amino-N-ethyl-5-fluorobenzenesulfonamide |
| InChIKey | DZLOYRBUNGDYHI-UHFFFAOYSA-N |
| SMILES | CCNS(=O)(=O)C1=C(C=CC(=C1)F)N |
Computed by PubChem (NCBI)