CAS 1094853-59-4 appears in our catalog under these names: 5-Amino-2-fluoro-n,n-dimethylbenzene-1-sulfonamide, 95%, 5-Amino-2-fluoro-N,N-dimethylbenzene-1-sulfonamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 100mg.
5-amino-2-fluoro-N,N-dimethylbenzenesulfonamide (CAS 1094853-59-4) is a chemical compound with the molecular formula C8H11FN2O2S and a molecular weight of 218.25 g/mol. IUPAC name: 5-amino-2-fluoro-N,N-dimethylbenzenesulfonamide. InChIKey: QIUAWBSACPMBRX-UHFFFAOYSA-N.
| Molecular formula | C8H11FN2O2S |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 5-amino-2-fluoro-N,N-dimethylbenzenesulfonamide |
| InChIKey | QIUAWBSACPMBRX-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=C(C=CC(=C1)N)F |
Computed by PubChem (NCBI)