CAS 80668-89-9 is the registry number for 4-Amino-2-fluoro-N,N-dimethylbenzenesulfonamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-2-fluoro-N,N-dimethylbenzenesulfonamide (CAS 80668-89-9) is a chemical compound with the molecular formula C8H11FN2O2S and a molecular weight of 218.25 g/mol. IUPAC name: 4-amino-2-fluoro-N,N-dimethylbenzenesulfonamide. InChIKey: CKQVAKQUIDTIHC-UHFFFAOYSA-N.
| Molecular formula | C8H11FN2O2S |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 4-amino-2-fluoro-N,N-dimethylbenzenesulfonamide |
| InChIKey | CKQVAKQUIDTIHC-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=C(C=C(C=C1)N)F |
Computed by PubChem (NCBI)