CAS 102664-66-4 appears in our catalog under these names: N,N',N''–Triphenyl–1,3,5–benzenetriamine, N,N',N''-Triphenyl-1,3,5-benzenetriamine, >98.0%(HPLC)(T), N,N',N''-Triphenyl-1,3,5-benzenetriamine 95%, N,N',N''-Triphenyl-1,3,5-benzenetriamine, 95%, 95%, N,N',N''-Triphenyl-1,3,5-benzenetriamine, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 250mg, 1g, 10g.
1-N,3-N,5-N-triphenylbenzene-1,3,5-triamine (CAS 102664-66-4) is a chemical compound with the molecular formula C24H21N3 and a molecular weight of 351.4 g/mol. IUPAC name: 1-N,3-N,5-N-triphenylbenzene-1,3,5-triamine. InChIKey: BMQHYGLEATWRFO-UHFFFAOYSA-N.
| Molecular formula | C24H21N3 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | 1-N,3-N,5-N-triphenylbenzene-1,3,5-triamine |
| InChIKey | BMQHYGLEATWRFO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC(=CC(=C2)NC3=CC=CC=C3)NC4=CC=CC=C4 |
Computed by PubChem (NCBI)