Products 923027-14-9
CAS 923027-14-9 is the registry number for 5'-(2-Aminophenyl)-[1,1':3',1''-terphenyl]-2,2''-diamine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[3,5-bis(2-aminophenyl)phenyl]aniline (CAS 923027-14-9) is a chemical compound with the molecular formula C24H21N3 and a molecular weight of 351.4 g/mol. IUPAC name: 2-[3,5-bis(2-aminophenyl)phenyl]aniline. InChIKey: CTBCGPDGIWWKAV-UHFFFAOYSA-N.
| Molecular formula | C24H21N3 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | 2-[3,5-bis(2-aminophenyl)phenyl]aniline |
| InChIKey | CTBCGPDGIWWKAV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=CC(=C2)C3=CC=CC=C3N)C4=CC=CC=C4N)N |
Computed by PubChem (NCBI)
Synonyms:
1,3,5-tris(aminophenyl) benzene