CAS 83255-45-2 is the registry number for N4-Tritylpyridine-3,4-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-N-tritylpyridine-3,4-diamine (CAS 83255-45-2) is a chemical compound with the molecular formula C24H21N3 and a molecular weight of 351.4 g/mol. IUPAC name: 4-N-tritylpyridine-3,4-diamine. InChIKey: KYRTWSOVBQVRKM-UHFFFAOYSA-N.
| Molecular formula | C24H21N3 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | 4-N-tritylpyridine-3,4-diamine |
| InChIKey | KYRTWSOVBQVRKM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)NC4=C(C=NC=C4)N |
Computed by PubChem (NCBI)