Products 102674-89-5
CAS 102674-89-5 is the registry number for PD 116779. Offered by: MedChemExpress. Available pack sizes: Get quote.
2,3,8-trihydroxy-3-methyl-2,4-dihydrobenzo[a]anthracene-1,7,12-trione (CAS 102674-89-5) is a chemical compound with the molecular formula C19H14O6 and a molecular weight of 338.3 g/mol. IUPAC name: 2,3,8-trihydroxy-3-methyl-2,4-dihydrobenzo[a]anthracene-1,7,12-trione. InChIKey: ZGIMJLWQWQRQNJ-UHFFFAOYSA-N.
| Molecular formula | C19H14O6 |
|---|---|
| Molecular weight | 338.3 g/mol |
| IUPAC name | 2,3,8-trihydroxy-3-methyl-2,4-dihydrobenzo[a]anthracene-1,7,12-trione |
| InChIKey | ZGIMJLWQWQRQNJ-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(C(=O)C1O)C3=C(C=C2)C(=O)C4=C(C3=O)C=CC=C4O)O |
Computed by PubChem (NCBI)