Products 2864816-15-7
CAS 2864816-15-7 is the registry number for Peniterphenyl A. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(4-hydroxyphenyl)-2-methoxydibenzofuran-1,7,8-triol (CAS 2864816-15-7) is a chemical compound with the molecular formula C19H14O6 and a molecular weight of 338.3 g/mol. IUPAC name: 3-(4-hydroxyphenyl)-2-methoxydibenzofuran-1,7,8-triol. InChIKey: FLAPMGRYQNUMDJ-UHFFFAOYSA-N.
| Molecular formula | C19H14O6 |
|---|---|
| Molecular weight | 338.3 g/mol |
| IUPAC name | 3-(4-hydroxyphenyl)-2-methoxydibenzofuran-1,7,8-triol |
| InChIKey | FLAPMGRYQNUMDJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1C3=CC=C(C=C3)O)OC4=CC(=C(C=C42)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
Peniterphenyl A, orb1981992