Products 3682-01-7

CAS 3682-01-7 is the registry number for Daidzein Diacetate. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 250mg, 500mg, 5 mg, 1 mg.

Structural formula: {0} (CAS {1})

[4-(7-acetyloxy-4-oxochromen-3-yl)phenyl] acetate (CAS 3682-01-7) is a chemical compound with the molecular formula C19H14O6 and a molecular weight of 338.3 g/mol. IUPAC name: [4-(7-acetyloxy-4-oxochromen-3-yl)phenyl] acetate. InChIKey: OHNNFNBOPWLDFH-UHFFFAOYSA-N.

Identity
Molecular formulaC19H14O6
Molecular weight338.3 g/mol
IUPAC name[4-(7-acetyloxy-4-oxochromen-3-yl)phenyl] acetate
InChIKeyOHNNFNBOPWLDFH-UHFFFAOYSA-N
SMILESCC(=O)OC1=CC=C(C=C1)C2=COC3=C(C2=O)C=CC(=C3)OC(=O)C

Computed by PubChem (NCBI)