CAS 3682-01-7 is the registry number for Daidzein Diacetate. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 250mg, 500mg, 5 mg, 1 mg.
[4-(7-acetyloxy-4-oxochromen-3-yl)phenyl] acetate (CAS 3682-01-7) is a chemical compound with the molecular formula C19H14O6 and a molecular weight of 338.3 g/mol. IUPAC name: [4-(7-acetyloxy-4-oxochromen-3-yl)phenyl] acetate. InChIKey: OHNNFNBOPWLDFH-UHFFFAOYSA-N.
| Molecular formula | C19H14O6 |
|---|---|
| Molecular weight | 338.3 g/mol |
| IUPAC name | [4-(7-acetyloxy-4-oxochromen-3-yl)phenyl] acetate |
| InChIKey | OHNNFNBOPWLDFH-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=C(C=C1)C2=COC3=C(C2=O)C=CC(=C3)OC(=O)C |
Computed by PubChem (NCBI)