CAS 102676-60-8 appears in our catalog under these names: Methyl 3-(1-tritylimidazol-4-yl) propionate, 95%, Methyl 3-(1-Tritylimidazol-4-yl) Propionate, Methyl 3-(1-trityl-1H-imidazol-4-yl)propanoate, 98%, Methyl 3-(1-tritylimidazol-4-yl) propionate, 96%, 96%. Offered by: Combi-blocks, TRC, AmBeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 500mg, 100mg.
Methyl 3-(1-tritylimidazol-4-yl)propanoate (CAS 102676-60-8) is a chemical compound with the molecular formula C26H24N2O2 and a molecular weight of 396.5 g/mol. IUPAC name: methyl 3-(1-tritylimidazol-4-yl)propanoate. InChIKey: FSUWVSSCCGVYLS-UHFFFAOYSA-N.
| Molecular formula | C26H24N2O2 |
|---|---|
| Molecular weight | 396.5 g/mol |
| IUPAC name | methyl 3-(1-tritylimidazol-4-yl)propanoate |
| InChIKey | FSUWVSSCCGVYLS-UHFFFAOYSA-N |
| SMILES | COC(=O)CCC1=CN(C=N1)C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)