CAS 127667-44-1 appears in our catalog under these names: 1,3-Bis(2-(4-cyanatophenyl)propan-2-yl)benzene 95%, 1,3-Bis(2-(4-cyanatophenyl)propan-2-yl)benzene, 95%, 95%, 1,3-Bis(2-(4-cyanatophenyl)propan-2-yl)benzene, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 100g, 500g.
[4-[2-[3-[2-(4-cyanatophenyl)propan-2-yl]phenyl]propan-2-yl]phenyl] cyanate (CAS 127667-44-1) is a chemical compound with the molecular formula C26H24N2O2 and a molecular weight of 396.5 g/mol. IUPAC name: [4-[2-[3-[2-(4-cyanatophenyl)propan-2-yl]phenyl]propan-2-yl]phenyl] cyanate. InChIKey: QODYBLNVIHQJIW-UHFFFAOYSA-N.
| Molecular formula | C26H24N2O2 |
|---|---|
| Molecular weight | 396.5 g/mol |
| IUPAC name | [4-[2-[3-[2-(4-cyanatophenyl)propan-2-yl]phenyl]propan-2-yl]phenyl] cyanate |
| InChIKey | QODYBLNVIHQJIW-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)OC#N)C2=CC(=CC=C2)C(C)(C)C3=CC=C(C=C3)OC#N |
Computed by PubChem (NCBI)