Products 64464-48-8
CAS 64464-48-8 is the registry number for 2-(1-Trityl-imidazol-4-yl)-2-methyl-propanoic acid. Offered by: Iris Biotech. Available pack sizes: 250mg, 1g, 5g.
2-methyl-2-(1-tritylimidazol-4-yl)propanoic acid (CAS 64464-48-8) is a chemical compound with the molecular formula C26H24N2O2 and a molecular weight of 396.5 g/mol. IUPAC name: 2-methyl-2-(1-tritylimidazol-4-yl)propanoic acid. InChIKey: QTPXCKDUAFPFIT-UHFFFAOYSA-N.
| Molecular formula | C26H24N2O2 |
|---|---|
| Molecular weight | 396.5 g/mol |
| IUPAC name | 2-methyl-2-(1-tritylimidazol-4-yl)propanoic acid |
| InChIKey | QTPXCKDUAFPFIT-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CN(C=N1)C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)C(=O)O |
Computed by PubChem (NCBI)