CAS 102677-74-7 is the registry number for 5-(Aminomethyl)-2-chloroaniline dihydrochloride, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
5-(aminomethyl)-2-chloroaniline;dihydrochloride (CAS 102677-74-7) is a chemical compound with the molecular formula C7H11Cl3N2 and a molecular weight of 229.5 g/mol. IUPAC name: 5-(aminomethyl)-2-chloroaniline;dihydrochloride. InChIKey: GGRUHFCZFKLAJR-UHFFFAOYSA-N.
| Molecular formula | C7H11Cl3N2 |
|---|---|
| Molecular weight | 229.5 g/mol |
| IUPAC name | 5-(aminomethyl)-2-chloroaniline;dihydrochloride |
| InChIKey | GGRUHFCZFKLAJR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CN)N)Cl.Cl.Cl |
Computed by PubChem (NCBI)