CAS 2411591-03-0 appears in our catalog under these names: (S)–1–(6–Chloropyridin–3–yl)ethan–1–amine dihydrochloride, (S)-1-(6-Chloropyridin-3-yl)ethan-1-amine dihydrochloride. Offered by: GLPBio, Biosynth. Available pack sizes: 100mg, 0,5g, 50mg.
(1S)-1-(6-chloro-3-pyridinyl)ethanamine;dihydrochloride (CAS 2411591-03-0) is a chemical compound with the molecular formula C7H11Cl3N2 and a molecular weight of 229.5 g/mol. IUPAC name: (1S)-1-(6-chloro-3-pyridinyl)ethanamine;dihydrochloride. InChIKey: LNWIEMNNGWWHTM-XRIGFGBMSA-N.
| Molecular formula | C7H11Cl3N2 |
|---|---|
| Molecular weight | 229.5 g/mol |
| IUPAC name | (1S)-1-(6-chloro-3-pyridinyl)ethanamine;dihydrochloride |
| InChIKey | LNWIEMNNGWWHTM-XRIGFGBMSA-N |
| SMILES | C[C@@H](C1=CN=C(C=C1)Cl)N.Cl.Cl |
Computed by PubChem (NCBI)