Products 1260787-89-0
CAS 1260787-89-0 appears in our catalog under these names: (3-Chlorobenzyl)hydrazine dihydrochloride, 95%, (3-Chlorobenzyl)hydrazine dihydrochloride, 97%, (3-Chlorobenzyl)hydrazine dihydrochloride, 95%, 95%, [(3-chlorophenyl)methyl]hydrazine dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g, 25g.
(3-chlorophenyl)methylhydrazine;dihydrochloride (CAS 1260787-89-0) is a chemical compound with the molecular formula C7H11Cl3N2 and a molecular weight of 229.5 g/mol. IUPAC name: (3-chlorophenyl)methylhydrazine;dihydrochloride. InChIKey: COAOTKOMDMUAPM-UHFFFAOYSA-N.
| Molecular formula | C7H11Cl3N2 |
|---|---|
| Molecular weight | 229.5 g/mol |
| IUPAC name | (3-chlorophenyl)methylhydrazine;dihydrochloride |
| InChIKey | COAOTKOMDMUAPM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)CNN.Cl.Cl |
Computed by PubChem (NCBI)