Products 1026926-30-6
CAS 1026926-30-6 is the registry number for BMS-199945. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-hydroxy-5-methyl-N-[(1,3,3-trimethylcyclohexyl)methyl]benzamide (CAS 1026926-30-6) is a chemical compound with the molecular formula C18H27NO2 and a molecular weight of 289.4 g/mol. IUPAC name: 2-hydroxy-5-methyl-N-[(1,3,3-trimethylcyclohexyl)methyl]benzamide. InChIKey: TWIXURCZKWRQTJ-UHFFFAOYSA-N.
| Molecular formula | C18H27NO2 |
|---|---|
| Molecular weight | 289.4 g/mol |
| IUPAC name | 2-hydroxy-5-methyl-N-[(1,3,3-trimethylcyclohexyl)methyl]benzamide |
| InChIKey | TWIXURCZKWRQTJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)O)C(=O)NCC2(CCCC(C2)(C)C)C |
Computed by PubChem (NCBI)