CAS 68489-09-8 appears in our catalog under these names: WS 12, WS-12/ 99.71% (existing batch purity), WS 12, (1R,2S,5R)-N-(4-Methoxyphenyl)-5-methyl-2-(1-methylethyl)cyclohexanecarboxamide, 98%, 98%, Acoltremon, 99.13%. Offered by: TRC, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 500mg, 5g.
(1R,2S,5R)-N-(4-methoxyphenyl)-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide (CAS 68489-09-8) is a chemical compound with the molecular formula C18H27NO2 and a molecular weight of 289.4 g/mol. IUPAC name: (1R,2S,5R)-N-(4-methoxyphenyl)-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide. InChIKey: HNSGVPAAXJJOPQ-XOKHGSTOSA-N.
| Molecular formula | C18H27NO2 |
|---|---|
| Molecular weight | 289.4 g/mol |
| IUPAC name | (1R,2S,5R)-N-(4-methoxyphenyl)-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide |
| InChIKey | HNSGVPAAXJJOPQ-XOKHGSTOSA-N |
| SMILES | C[C@@H]1CC[C@H]([C@@H](C1)C(=O)NC2=CC=C(C=C2)OC)C(C)C |
Computed by PubChem (NCBI)