CAS 2760568-36-1 is the registry number for tert-Butyl 2,5-dimethyl-2-phenylpiperidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2,5-dimethyl-2-phenylpiperidine-1-carboxylate (CAS 2760568-36-1) is a chemical compound with the molecular formula C18H27NO2 and a molecular weight of 289.4 g/mol. IUPAC name: tert-butyl 2,5-dimethyl-2-phenylpiperidine-1-carboxylate. InChIKey: OTQYQKUGVHNNPW-UHFFFAOYSA-N.
| Molecular formula | C18H27NO2 |
|---|---|
| Molecular weight | 289.4 g/mol |
| IUPAC name | tert-butyl 2,5-dimethyl-2-phenylpiperidine-1-carboxylate |
| InChIKey | OTQYQKUGVHNNPW-UHFFFAOYSA-N |
| SMILES | CC1CCC(N(C1)C(=O)OC(C)(C)C)(C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)