Products 1027059-21-7

CAS 1027059-21-7 appears in our catalog under these names: 2,6-Dichloro-3-(trifluoromethyl)phenylboronic acid, 95%, (2,6-Dichloro-3-(trifluoromethyl)phenyl)boronic acid, 98+%, 2,6-Dichloro-3-(trifluoromethyl)phenylboronic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

[2,6-dichloro-3-(trifluoromethyl)phenyl]boronic acid (CAS 1027059-21-7) is a chemical compound with the molecular formula C7H4BCl2F3O2 and a molecular weight of 258.82 g/mol. IUPAC name: [2,6-dichloro-3-(trifluoromethyl)phenyl]boronic acid. InChIKey: WPEZCAHXSFQDDO-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4BCl2F3O2
Molecular weight258.82 g/mol
IUPAC name[2,6-dichloro-3-(trifluoromethyl)phenyl]boronic acid
InChIKeyWPEZCAHXSFQDDO-UHFFFAOYSA-N
SMILESB(C1=C(C=CC(=C1Cl)C(F)(F)F)Cl)(O)O

Computed by PubChem (NCBI)