CAS 1887240-36-9 appears in our catalog under these names: 2,6-Dichloro-4-(trifluoromethyl)phenylboronic acid, 95%, 2,6-Dichloro-4-(trifluoromethyl)phenylboronic acid, 98%, 2,6-Dichloro-4-(Trifluoromethyl)Phenylboronic Acid, (2,6-Dichloro-4-(trifluoromethyl)phenyl)boronic acid. Offered by: Combi-blocks, AmBeed, TRC, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
[2,6-dichloro-4-(trifluoromethyl)phenyl]boronic acid (CAS 1887240-36-9) is a chemical compound with the molecular formula C7H4BCl2F3O2 and a molecular weight of 258.82 g/mol. IUPAC name: [2,6-dichloro-4-(trifluoromethyl)phenyl]boronic acid. InChIKey: UWHPSRANHQGNHM-UHFFFAOYSA-N.
| Molecular formula | C7H4BCl2F3O2 |
|---|---|
| Molecular weight | 258.82 g/mol |
| IUPAC name | [2,6-dichloro-4-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | UWHPSRANHQGNHM-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1Cl)C(F)(F)F)Cl)(O)O |
Computed by PubChem (NCBI)