CAS 2121511-64-4 appears in our catalog under these names: 4,5-Dichloro-2-(trifluoromethyl)phenylboronic acid, 95%, 4,5-Dichloro-2-(trifluoromethyl)phenylboronic acid, ≥95%, ≥95%, 4,5-Dichloro-2-(trifluoromethyl)phenylboronic acid. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 250mg, 1g.
[4,5-dichloro-2-(trifluoromethyl)phenyl]boronic acid (CAS 2121511-64-4) is a chemical compound with the molecular formula C7H4BCl2F3O2 and a molecular weight of 258.82 g/mol. IUPAC name: [4,5-dichloro-2-(trifluoromethyl)phenyl]boronic acid. InChIKey: FSSXKLWMZSVERL-UHFFFAOYSA-N.
| Molecular formula | C7H4BCl2F3O2 |
|---|---|
| Molecular weight | 258.82 g/mol |
| IUPAC name | [4,5-dichloro-2-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | FSSXKLWMZSVERL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1C(F)(F)F)Cl)Cl)(O)O |
Computed by PubChem (NCBI)