Products 102717-01-1

CAS 102717-01-1 is the registry number for Lenvatinib Mesilate Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-chloro-2-phenyldiazenylphenol (CAS 102717-01-1) is a chemical compound with the molecular formula C12H9ClN2O and a molecular weight of 232.66 g/mol. IUPAC name: 5-chloro-2-phenyldiazenylphenol. InChIKey: YHWVVPOOJQRLNF-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9ClN2O
Molecular weight232.66 g/mol
IUPAC name5-chloro-2-phenyldiazenylphenol
InChIKeyYHWVVPOOJQRLNF-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)N=NC2=C(C=C(C=C2)Cl)O

Computed by PubChem (NCBI)