Products 133308-61-9
CAS 133308-61-9 is the registry number for 4'-Methyl(2,2'-bipyridine)-4-carbonyl Chloride. Offered by: TRC. Available pack sizes: 500mg.
2-(4-methyl-2-pyridinyl)pyridine-4-carbonyl chloride (CAS 133308-61-9) is a chemical compound with the molecular formula C12H9ClN2O and a molecular weight of 232.66 g/mol. IUPAC name: 2-(4-methyl-2-pyridinyl)pyridine-4-carbonyl chloride. InChIKey: DDRHVONSHPYZCR-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN2O |
|---|---|
| Molecular weight | 232.66 g/mol |
| IUPAC name | 2-(4-methyl-2-pyridinyl)pyridine-4-carbonyl chloride |
| InChIKey | DDRHVONSHPYZCR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC=C1)C2=NC=CC(=C2)C(=O)Cl |
Computed by PubChem (NCBI)