CAS 591754-12-0 is the registry number for N–(2–Chloro–4–pyridinyl)benzamide. Offered by: GLPBio. Available pack sizes: 25mg.
N-(2-chloro-4-pyridinyl)benzamide (CAS 591754-12-0) is a chemical compound with the molecular formula C12H9ClN2O and a molecular weight of 232.66 g/mol. IUPAC name: N-(2-chloro-4-pyridinyl)benzamide. InChIKey: QIAMRMDFJCKFNO-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN2O |
|---|---|
| Molecular weight | 232.66 g/mol |
| IUPAC name | N-(2-chloro-4-pyridinyl)benzamide |
| InChIKey | QIAMRMDFJCKFNO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=CC(=NC=C2)Cl |
Computed by PubChem (NCBI)