CAS 1027433-84-6 is the registry number for 4,4-Dimethyl-2-phenyloxazoline-13C6. Offered by: TRC. Available pack sizes: 250mg.
2-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-4,4-dimethyl-5H-1,3-oxazole (CAS 1027433-84-6) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 181.18 g/mol. IUPAC name: 2-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-4,4-dimethyl-5H-1,3-oxazole. InChIKey: UGNSMKDDFAUGFT-BWDSVOIGSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 181.18 g/mol |
| IUPAC name | 2-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-4,4-dimethyl-5H-1,3-oxazole |
| InChIKey | UGNSMKDDFAUGFT-BWDSVOIGSA-N |
| SMILES | CC1(COC(=N1)[13C]2=[13CH][13CH]=[13CH][13CH]=[13CH]2)C |
Computed by PubChem (NCBI)