CAS 639516-58-8 is the registry number for 2-Phenyl-d5-4,4-dimethyl-4,5-dihydrooxazole. Offered by: TRC. Available pack sizes: 50mg, 5mg.
4,4-dimethyl-2-(2,3,4,5,6-pentadeuteriophenyl)-5H-1,3-oxazole (CAS 639516-58-8) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 180.26 g/mol. IUPAC name: 4,4-dimethyl-2-(2,3,4,5,6-pentadeuteriophenyl)-5H-1,3-oxazole. InChIKey: UGNSMKDDFAUGFT-DKFMXDSJSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 180.26 g/mol |
| IUPAC name | 4,4-dimethyl-2-(2,3,4,5,6-pentadeuteriophenyl)-5H-1,3-oxazole |
| InChIKey | UGNSMKDDFAUGFT-DKFMXDSJSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2=NC(CO2)(C)C)[2H])[2H] |
Computed by PubChem (NCBI)