CAS 1027513-81-0 appears in our catalog under these names: 1-Bromo-2-(2,2,2-trifluoroethyl)benzene, 95%, 1-Bromo-2-(2,2,2-trifluoroethyl)benzene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 1g, 2,5g.
1-bromo-2-(2,2,2-trifluoroethyl)benzene (CAS 1027513-81-0) is a chemical compound with the molecular formula C8H6BrF3 and a molecular weight of 239.03 g/mol. IUPAC name: 1-bromo-2-(2,2,2-trifluoroethyl)benzene. InChIKey: USTNSUARVYHWHF-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3 |
|---|---|
| Molecular weight | 239.03 g/mol |
| IUPAC name | 1-bromo-2-(2,2,2-trifluoroethyl)benzene |
| InChIKey | USTNSUARVYHWHF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(F)(F)F)Br |
Computed by PubChem (NCBI)