CAS 402-23-3 appears in our catalog under these names: 3–(Trifluoromethyl)benzyl bromide, 3-(Trifluoromethyl)benzyl bromide, 3-(Trifluoromethyl)benzyl bromide, 98%, 3-(Trifluoromethyl)benzyl bromide, 98% , 3-(Trifluoromethyl)benzyl Bromide, >98.0%(GC). Offered by: GLPBio, Fluorochem, Combi-blocks, Thermo Scientific (Alfa Aesar), Sigma-Aldrich. Available pack sizes: 25g, 1g, 5g, 10g, 100g, 500g.
1-(bromomethyl)-3-(trifluoromethyl)benzene (CAS 402-23-3) is a chemical compound with the molecular formula C8H6BrF3 and a molecular weight of 239.03 g/mol. IUPAC name: 1-(bromomethyl)-3-(trifluoromethyl)benzene. InChIKey: MYYYZNVAUZVXBO-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3 |
|---|---|
| Molecular weight | 239.03 g/mol |
| IUPAC name | 1-(bromomethyl)-3-(trifluoromethyl)benzene |
| InChIKey | MYYYZNVAUZVXBO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)CBr |
Computed by PubChem (NCBI)