CAS 163975-05-1 appears in our catalog under these names: 1-Bromo-3-(2,2,2-Trifluoroethyl)Benzene, 1-Bromo-3-(2,2,2-trifluoroethyl)-benzene, 1-Bromo-3-(2,2,2-trifluoroethyl)benzene, 95%. Offered by: Biosynth, Fluorochem, Combi-blocks. Available pack sizes: 1g, 250mg, 10g, 5g.
1-bromo-3-(2,2,2-trifluoroethyl)benzene (CAS 163975-05-1) is a chemical compound with the molecular formula C8H6BrF3 and a molecular weight of 239.03 g/mol. IUPAC name: 1-bromo-3-(2,2,2-trifluoroethyl)benzene. InChIKey: CQVBJYBIGXUWPB-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3 |
|---|---|
| Molecular weight | 239.03 g/mol |
| IUPAC name | 1-bromo-3-(2,2,2-trifluoroethyl)benzene |
| InChIKey | CQVBJYBIGXUWPB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)CC(F)(F)F |
Computed by PubChem (NCBI)