CAS 1027514-27-7 appears in our catalog under these names: Ethyl difluoro(4-(propan-2-yl)phenyl)acetate, 95-<97%, Ethyl 2,2-difluoro-2-(4-isopropylphenyl)acetate, 96%, 96%, Ethyl-2,2-difluoro-2-(4-isopropylphenyl)acetate. Offered by: Hoffman Fine Chemicals, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 100mg, 250mg, 1g.
Ethyl 2,2-difluoro-2-(4-propan-2-ylphenyl)acetate (CAS 1027514-27-7) is a chemical compound with the molecular formula C13H16F2O2 and a molecular weight of 242.26 g/mol. IUPAC name: ethyl 2,2-difluoro-2-(4-propan-2-ylphenyl)acetate. InChIKey: CRNSFQGKWLNQLK-UHFFFAOYSA-N.
| Molecular formula | C13H16F2O2 |
|---|---|
| Molecular weight | 242.26 g/mol |
| IUPAC name | ethyl 2,2-difluoro-2-(4-propan-2-ylphenyl)acetate |
| InChIKey | CRNSFQGKWLNQLK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CC=C(C=C1)C(C)C)(F)F |
Computed by PubChem (NCBI)