CAS 2567498-78-4 is the registry number for 3'-(1,1-Difluoroethyl)-(1,1'-bi(bicyclo(1.1.1)pentane))-3-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 100mg, 5g, 1g.
3-[3-(1,1-difluoroethyl)-1-bicyclo[1.1.1]pentanyl]bicyclo[1.1.1]pentane-1-carboxylic acid (CAS 2567498-78-4) is a chemical compound with the molecular formula C13H16F2O2 and a molecular weight of 242.26 g/mol. IUPAC name: 3-[3-(1,1-difluoroethyl)-1-bicyclo[1.1.1]pentanyl]bicyclo[1.1.1]pentane-1-carboxylic acid. InChIKey: SYLZQNLSDUQOET-UHFFFAOYSA-N.
| Molecular formula | C13H16F2O2 |
|---|---|
| Molecular weight | 242.26 g/mol |
| IUPAC name | 3-[3-(1,1-difluoroethyl)-1-bicyclo[1.1.1]pentanyl]bicyclo[1.1.1]pentane-1-carboxylic acid |
| InChIKey | SYLZQNLSDUQOET-UHFFFAOYSA-N |
| SMILES | CC(C12CC(C1)(C2)C34CC(C3)(C4)C(=O)O)(F)F |
Computed by PubChem (NCBI)