CAS 1436389-43-3 appears in our catalog under these names: Ethyl 2,2-difluoro-2-mesitylacetate, 90%, ethyl 2,2–difluoro–2–(2,4,6–trimethylphenyl)acetate, ethyl 2,2-difluoro-2-(2,4,6-trimethylphenyl)acetate. Offered by: Hoffman Fine Chemicals, GLPBio, Chemat. Available pack sizes: 10g, 25g, 50g, 100g, 1g, 250mg, 5g, 50mg.
Ethyl 2,2-difluoro-2-(2,4,6-trimethylphenyl)acetate (CAS 1436389-43-3) is a chemical compound with the molecular formula C13H16F2O2 and a molecular weight of 242.26 g/mol. IUPAC name: ethyl 2,2-difluoro-2-(2,4,6-trimethylphenyl)acetate. InChIKey: JXVKELVOIVUDKC-UHFFFAOYSA-N.
| Molecular formula | C13H16F2O2 |
|---|---|
| Molecular weight | 242.26 g/mol |
| IUPAC name | ethyl 2,2-difluoro-2-(2,4,6-trimethylphenyl)acetate |
| InChIKey | JXVKELVOIVUDKC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=C(C=C(C=C1C)C)C)(F)F |
Computed by PubChem (NCBI)