Products 1027535-73-4
CAS 1027535-73-4 is the registry number for 2-(4-(5-chloro-2-methylphenyl)piperazine-1-carbonyl)-1H-indole. Offered by: Biosynth. Available pack sizes: 250mg.
[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-(1H-indol-2-yl)methanone (CAS 1027535-73-4) is a chemical compound with the molecular formula C20H20ClN3O and a molecular weight of 353.8 g/mol. IUPAC name: [4-(5-chloro-2-methylphenyl)piperazin-1-yl]-(1H-indol-2-yl)methanone. InChIKey: UMOKEEPYTLUVED-UHFFFAOYSA-N.
| Molecular formula | C20H20ClN3O |
|---|---|
| Molecular weight | 353.8 g/mol |
| IUPAC name | [4-(5-chloro-2-methylphenyl)piperazin-1-yl]-(1H-indol-2-yl)methanone |
| InChIKey | UMOKEEPYTLUVED-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Cl)N2CCN(CC2)C(=O)C3=CC4=CC=CC=C4N3 |
Computed by PubChem (NCBI)