Products 550-81-2
CAS 550-81-2 appears in our catalog under these names: Amopyroquine, 95%, Amopyroquine. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 50mg, 5mg, 10mg, 25mg, 100mg.
4-[(7-chloroquinolin-4-yl)amino]-2-(pyrrolidin-1-ylmethyl)phenol (CAS 550-81-2) is a chemical compound with the molecular formula C20H20ClN3O and a molecular weight of 353.8 g/mol. IUPAC name: 4-[(7-chloroquinolin-4-yl)amino]-2-(pyrrolidin-1-ylmethyl)phenol. InChIKey: YNWCUCSDUMVJKR-UHFFFAOYSA-N.
| Molecular formula | C20H20ClN3O |
|---|---|
| Molecular weight | 353.8 g/mol |
| IUPAC name | 4-[(7-chloroquinolin-4-yl)amino]-2-(pyrrolidin-1-ylmethyl)phenol |
| InChIKey | YNWCUCSDUMVJKR-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)CC2=C(C=CC(=C2)NC3=C4C=CC(=CC4=NC=C3)Cl)O |
Computed by PubChem (NCBI)