CAS 1373887-29-6 appears in our catalog under these names: ER176, ER176, 99%, 99%, ER176, 99.77%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10 mg, 25 mg, 5 mg.
N-[(2R)-butan-2-yl]-4-(2-chlorophenyl)-N-methylquinazoline-2-carboxamide (CAS 1373887-29-6) is a chemical compound with the molecular formula C20H20ClN3O and a molecular weight of 353.8 g/mol. IUPAC name: N-[(2R)-butan-2-yl]-4-(2-chlorophenyl)-N-methylquinazoline-2-carboxamide. InChIKey: ASFLYNMYGAYKON-CYBMUJFWSA-N.
| Molecular formula | C20H20ClN3O |
|---|---|
| Molecular weight | 353.8 g/mol |
| IUPAC name | N-[(2R)-butan-2-yl]-4-(2-chlorophenyl)-N-methylquinazoline-2-carboxamide |
| InChIKey | ASFLYNMYGAYKON-CYBMUJFWSA-N |
| SMILES | CC[C@@H](C)N(C)C(=O)C1=NC2=CC=CC=C2C(=N1)C3=CC=CC=C3Cl |
Computed by PubChem (NCBI)