Products 102768-28-5
CAS 102768-28-5 is the registry number for Dithranol Impurity 9. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
1,8-dihydroxy-10-(2-methylpropanoyl)-10H-anthracen-9-one (CAS 102768-28-5) is a chemical compound with the molecular formula C18H16O4 and a molecular weight of 296.3 g/mol. IUPAC name: 1,8-dihydroxy-10-(2-methylpropanoyl)-10H-anthracen-9-one. InChIKey: SUJSJBSFBVHOPA-UHFFFAOYSA-N.
| Molecular formula | C18H16O4 |
|---|---|
| Molecular weight | 296.3 g/mol |
| IUPAC name | 1,8-dihydroxy-10-(2-methylpropanoyl)-10H-anthracen-9-one |
| InChIKey | SUJSJBSFBVHOPA-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)C1C2=C(C(=CC=C2)O)C(=O)C3=C1C=CC=C3O |
Computed by PubChem (NCBI)