CAS 102781-26-0 is the registry number for (((5-bromo-2-pyridyl)amino)methylene)methane-1,1-dicarbonitrile. Offered by: Biosynth. Available pack sizes: 250mg.
2-[[(5-bromo-2-pyridinyl)amino]methylidene]propanedinitrile (CAS 102781-26-0) is a chemical compound with the molecular formula C9H5BrN4 and a molecular weight of 249.07 g/mol. IUPAC name: 2-[[(5-bromo-2-pyridinyl)amino]methylidene]propanedinitrile. InChIKey: TXWIAEBDXVYDGM-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN4 |
|---|---|
| Molecular weight | 249.07 g/mol |
| IUPAC name | 2-[[(5-bromo-2-pyridinyl)amino]methylidene]propanedinitrile |
| InChIKey | TXWIAEBDXVYDGM-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1Br)NC=C(C#N)C#N |
Computed by PubChem (NCBI)