CAS 1028-86-0 appears in our catalog under these names: N-(2-Chloropyridin-3-yl)-2-nitrobenzamide 95%, N-(2-Chloropyridin-3-yl)-2-nitrobenzamide, 95%, 95%, N-(2-Chloropyridin-3-yl)-2-nitrobenzamide, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
N-(2-chloro-3-pyridinyl)-2-nitrobenzamide (CAS 1028-86-0) is a chemical compound with the molecular formula C12H8ClN3O3 and a molecular weight of 277.66 g/mol. IUPAC name: N-(2-chloro-3-pyridinyl)-2-nitrobenzamide. InChIKey: JZEBEDCRJXPXIC-UHFFFAOYSA-N.
| Molecular formula | C12H8ClN3O3 |
|---|---|
| Molecular weight | 277.66 g/mol |
| IUPAC name | N-(2-chloro-3-pyridinyl)-2-nitrobenzamide |
| InChIKey | JZEBEDCRJXPXIC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC2=C(N=CC=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)