CAS 214476-09-2 appears in our catalog under these names: 4-Chloro-3-cyano-7-ethoxy-6-nitroquinoline, 95%, 4–Chloro–3–cyano–7–ethoxy–6–nitroquinoline. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
4-chloro-7-ethoxy-6-nitroquinoline-3-carbonitrile (CAS 214476-09-2) is a chemical compound with the molecular formula C12H8ClN3O3 and a molecular weight of 277.66 g/mol. IUPAC name: 4-chloro-7-ethoxy-6-nitroquinoline-3-carbonitrile. InChIKey: PTCUBEZCMHJCMK-UHFFFAOYSA-N.
| Molecular formula | C12H8ClN3O3 |
|---|---|
| Molecular weight | 277.66 g/mol |
| IUPAC name | 4-chloro-7-ethoxy-6-nitroquinoline-3-carbonitrile |
| InChIKey | PTCUBEZCMHJCMK-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C2C(=C1)N=CC(=C2Cl)C#N)[N+](=O)[O-] |
Computed by PubChem (NCBI)